BD0718153
1-Oxo-1,3-dihydroisobenzofuran-5-carboxylicacid , 98% , 4792-29-4
CAS NO.:4792-29-4
Empirical Formula: C9H6O4
Molecular Weight: 178.14
MDL number: MFCD04117971
EINECS: 225-343-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB194.40 | In Stock |
|
| 1g | RMB537.60 | In Stock |
|
| 5g | RMB1482.40 | In Stock |
|
| 25g | RMB4184.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 481.1±45.0 °C(Predicted) |
| Density | 1.502 |
| storage temp. | Store at room temperature |
| pka | 3.73±0.20(Predicted) |
| form | solid |
| color | white |
| InChI | InChI=1S/C9H6O4/c10-8(11)5-1-2-7-6(3-5)4-13-9(7)12/h1-3H,4H2,(H,10,11) |
| InChIKey | QTWUWCFGWYYRRL-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(C(O)=O)C=C2)CO1 |
| CAS DataBase Reference | 4792-29-4(CAS DataBase Reference) |
Description and Uses
5-Carboxyphthalide is used in the cosmetic treatment method as a condensation polymer of the cosmetic composition.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |



