BD0722853
2,9-Dimethylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone , 92% , 5521-31-3
Synonym(s):
2,9-Dimethyl-anthra[2,1,9-def:6,5,10-d′e′f′]diisoquinoline-1,3,8,10(2H,9H)-tetrone;MePTC;MePTCDI
CAS NO.:5521-31-3
Empirical Formula: C26H14N2O4
Molecular Weight: 418.4
MDL number: MFCD00071975
EINECS: 226-866-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB56.00 | In Stock |
|
| 250mg | RMB83.20 | In Stock |
|
| 1g | RMB149.60 | In Stock |
|
| 5g | RMB424.80 | In Stock |
|
| 25g | RMB1301.60 | In Stock |
|
| 100g | RMB3178.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >400°C |
| Boiling point: | 694.8±28.0 °C(Predicted) |
| Density | 1.594±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -2.29±0.20(Predicted) |
| form | powder |
| color | Orange to Brown to Dark purple |
| Water Solubility | 5.5μg/L at 23℃ |
| semiconductor properties | N-type (mobility=10-5cm2/V·s) |
| λmax | 550nm(H2SO4)(lit.) |
| InChI | InChI=1S/C26H14N2O4/c1-27-23(29)15-7-3-11-13-5-9-17-22-18(26(32)28(2)25(17)31)10-6-14(20(13)22)12-4-8-16(24(27)30)21(15)19(11)12/h3-10H,1-2H3 |
| InChIKey | PJQYNUFEEZFYIS-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C3C4C(C5=CC=C6C7=C5C(C=4C=C2)=CC=C7C(=O)N(C)C6=O)=CC=C3C(=O)N1C |
| LogP | -0.033 at 23℃ |
| EPA Substance Registry System | 2,9-Dimethylanthra(2,1,9-def:6,5,10-d'e'f')diisoquinoline-1,3,8,10(2H,9H)-tetrone (5521-31-3) |
Description and Uses
Me-PTCDI can be used in the preparation of the hole transporting layers (HTLs), which can further be utilized in the fabrication of perovskite photovoltaic (PPV) cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | CB1590000 |
| TSCA | TSCA listed |
| HS Code | 2925.19.4200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![2,9-Dimethylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone](https://img.chemicalbook.com/CAS/GIF/5521-31-3.gif)

![3,10-Dimethylquinolino[2,3-b]acridine-7,14(5H,12H)-dione](https://img.chemicalbook.com/CAS/GIF/16043-40-6.gif)
![2,9-Dimethylquinolino[2,3-b]acridine-7,14(5H,12H)-dione](https://img.chemicalbook.com/CAS/GIF/980-26-7.gif)


