BD0726753
4,4-Diethoxy-N,N-dimethyl-1-butanamine , 97% , 1116-77-4
Synonym(s):
N,N-Dimethyl-4-aminobutanal diethyl acetal;1-(N,N-Dimethylamino)-4,4-diethoxybutane;4,4-Diethoxy-N,N-dimethyl-1-butanamine;4,4-Diethoxy-N,N-dimethylbutanamine;4,4-Diethoxy-N,N-dimethylbutylamine
CAS NO.:1116-77-4
Empirical Formula: C10H23NO2
Molecular Weight: 189.3
MDL number: MFCD00671479
EINECS: 601-109-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB87.20 | In Stock |
|
| 25g | RMB316.80 | In Stock |
|
| 100g | RMB952.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 194-195C |
| Density | 0.844 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| pka | 9.71±0.28(Predicted) |
| color | Colourless to Pale Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C10H23NO2/c1-5-12-10(13-6-2)8-7-9-11(3)4/h10H,5-9H2,1-4H3 |
| InChIKey | QKXMWBLNSPNBEY-UHFFFAOYSA-N |
| SMILES | C(N(C)C)CCC(OCC)OCC |
| CAS DataBase Reference | 1116-77-4(CAS DataBase Reference) |
Description and Uses
4,4-Diethoxy-N,N-dimethyl-1-butanamine is used in organic synthesis and pharmaceutical intermediates, it is an intermediate for Sumatriptan, Rizatriptan, Almotriptan, Zolmitriptan.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338+P310 |
| Hazard Codes | Xi,C |
| Risk Statements | 41-34-10-36/37/38 |
| Safety Statements | 26-36/37/39-16-37 |
| RIDADR | UN 3267 8 / PGIII |
| WGK Germany | 3 |
| HS Code | 29225090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 |







