BD0733532
2,2,4,6,7-Pentamethyl-2,3-dihydrobenzofuran-5-sulfonyl chloride , 96% , 154445-78-0
Synonym(s):
Pbf-Cl
CAS NO.:154445-78-0
Empirical Formula: C13H17ClO3S
Molecular Weight: 288.79
MDL number: MFCD01317847
| Pack Size | Price | Stock | Quantity |
| 5g | RMB240.00 | In Stock |
|
| 10g | RMB409.60 | In Stock |
|
| 25g | RMB820.00 | In Stock |
|
| 100g | RMB2542.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C |
| Boiling point: | 392.7±42.0 °C(Predicted) |
| Density | 1.236±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) |
| form | solid |
| color | Blue |
| BRN | 6602917 |
| Stability: | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H17ClO3S/c1-7-8(2)12(18(14,15)16)9(3)10-6-13(4,5)17-11(7)10/h6H2,1-5H3 |
| InChIKey | HLJKUZUILACRPQ-UHFFFAOYSA-N |
| SMILES | O1C2=C(C)C(C)=C(S(Cl)(=O)=O)C(C)=C2CC1(C)C |
| CAS DataBase Reference | 154445-78-0(CAS DataBase Reference) |
Description and Uses
reagent for introducing the PBF protection in arginine’s guanidine group
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 2932990090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |




