BD0734732
Esomeprazole Magnesium(Random Configuration) , 97% , 161973-10-0
Synonym(s):
(S)-Omeprazole magnesium trihydrate;5-Methoxy-2-{(S)-[(4-methoxy-3,5-dimethyl-2-pyridyl)methyl] sulfinyl} benzimidazole magnesium trihydrate
CAS NO.:161973-10-0
Empirical Formula: C34H36MgN6O6S2
Molecular Weight: 713.12
MDL number:
EINECS: 627-029-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB64.00 | In Stock |
|
| 1g | RMB160.00 | In Stock |
|
| 5g | RMB400.00 | In Stock |
|
| 25g | RMB1280.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >169°C (dec.) |
| alpha | D20 -128.2° (c = 1 in methanol) |
| Boiling point: | 600° |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Beige |
| BCS Class | 3 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/2C17H18N3O3S.Mg/c2*1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17;/h2*5-8H,9H2,1-4H3;/q2*-1;+2 |
| InChIKey | KWORUUGOSLYAGD-UHFFFAOYSA-N |
| SMILES | C(C1N=CC(C)=C(OC)C=1C)S1C2[N-]C3=CC(OC)=CC=C3N=2[Mg+2]2(O=S(CC3N=CC(C)=C(OC)C=3C)C3[N-]C4=CC(OC)=CC=C4N2=3)O=1 |
Description and Uses
S-Form of Omeprazole. Gastric proton-pump inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |





![2-[[(4-Methoxy-3,5-dimethyl-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole](https://img.chemicalbook.com/CAS/20150408/GIF/73590-60-0.gif)

