BD0737445
EthylN-cyanoacetimidate , 97% , 1558-82-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB32.80 | In Stock |
|
| 10g | RMB63.20 | In Stock |
|
| 25g | RMB141.60 | In Stock |
|
| 100g | RMB494.40 | In Stock |
|
| 500g | RMB1739.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81 °C(Solv: ethyl ether (60-29-7)) |
| Boiling point: | 133.2±23.0 °C(Predicted) |
| Density | 0.94 |
| refractive index | 1.45 |
| Flash point: | 34° |
| storage temp. | 2-8°C |
| pka | -2.94±0.50(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C5H8N2O/c1-3-8-5(2)7-4-6/h3H2,1-2H3 |
| InChIKey | PLVWUINOWYHRAA-UHFFFAOYSA-N |
| SMILES | C(=NC#N)(OCC)C |
| CAS DataBase Reference | 1558-82-3(CAS DataBase Reference) |
Description and Uses
Ethyl N-cyanoethanimideate is used as an intermediate for the highly effective and low-toxicity pesticide acetamiprid.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P261-P280-P301+P310-P302+P352-P304+P340-P305+P351+P338-P311 |
| RIDADR | UN3273 |
| HS Code | 2926.90.5050 |
| HazardClass | 3, 6.1 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





