BD0739845
Benzo-18-crown6-Ether , 96% , 14098-24-9
CAS NO.:14098-24-9
Empirical Formula: C16H24O6
Molecular Weight: 312.36
MDL number: MFCD00062741
EINECS: 604-215-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB208.80 | In Stock |
|
| 5g | RMB760.80 | In Stock |
|
| 25g | RMB3694.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-45 °C (lit.) |
| Boiling point: | 412.28°C (rough estimate) |
| Density | 1.1858 (rough estimate) |
| refractive index | 1.4795 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | very faint turbidity in Methanol |
| form | Liquid |
| color | Clear colorless |
| Sensitive | Hygroscopic |
| BRN | 1626123 |
| InChI | InChI=1S/C16H24O6/c1-2-4-16-15(3-1)21-13-11-19-9-7-17-5-6-18-8-10-20-12-14-22-16/h1-4H,5-14H2 |
| InChIKey | DSFHXKRFDFROER-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OCCOCCOCCOCCOCC1 |
| CAS DataBase Reference | 14098-24-9(CAS DataBase Reference) |
Description and Uses
Benzo-18-crown-6-ether (B18C6) is an organic compound that can be used to prepare stable microcapsule responsive layers for further assembly into bilayer microcapsules. For example, 18-Crown-6-ether is used to prepare the response layer and is coated with a G-quadruplex cross-linked hydrogel layer stabilized by K+; when Mg2+ ions are present, 18-Crown-6-ether and K+ ions can respectively Dissociates and locks with the G-quadruplex cross-linked layer, thereby achieving switchable controlled release of the load[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329985 |
| Storage Class | 11 - Combustible Solids |




