BD0741848
(R)-(1-Ethylpyrrolidin-2-yl)methanamine , 98% , 22795-97-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB2640.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 50-52 °C(lit.) |
| Density | 0.90 |
| refractive index | 1.4655-1.4675 |
| Flash point: | 57 °C |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Hexane , Methanol |
| form | Liquid |
| pka | 10.04±0.40(Predicted) |
| color | Clear colorless to yellow |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C7H16N2/c1-2-9-5-3-4-7(9)6-8/h7H,2-6,8H2,1H3/t7-/m1/s1 |
| InChIKey | UNRBEYYLYRXYCG-SSDOTTSWSA-N |
| SMILES | N1(CC)CCC[C@@H]1CN |
| CAS DataBase Reference | 22795-97-7(CAS DataBase Reference) |
Description and Uses
R-(+)-2-Aminomethyl-N-ethylpyrrolidine, is a chiral building block used for the synthesis of various biologically active compounds, such as Amisulpride (A633250). It can also be used for the synthesis of several novel heterocyclic-fused naphthalimides intercalators with chiral amino side chains, acting as antitumor agents.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H302-H315-H318-H335 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 37/39-26-36-39-60-36/37/39-23 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| HazardClass | 8 |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |






![[D-PRO2, D-TRP7,9]-SUBSTANCE P](https://img.chemicalbook.com/CAS/GIF/80434-86-2.gif)


