BD0755648
2-Oxa-6-azaspiro[3.5]nonane , 98% , 1046153-20-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB8643.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-136°C |
| Boiling point: | 208℃ |
| Density | 1.04 |
| Flash point: | 74℃ |
| storage temp. | 2-8°C(protect from light) |
| pka | 10.73±0.20(Predicted) |
| form | liquid |
| color | Colourless |
| InChI | 1S/C7H13NO.C2H2O4/c1-2-7(4-8-3-1)5-9-6-7;3-1(4)2(5)6/h8H,1-6H2;(H,3,4)(H,5,6) |
| InChIKey | SDESQEIYRGXXPA-UHFFFAOYSA-N |
| SMILES | OC(=O)C(O)=O.C1CNCC2(C1)COC2 |
Description and Uses
2-Oxa-6-azaspiro[3.5]nonane is a spirocyclic compound containing oxygen and nitrogen atoms. As an important building block for drug synthesis and a pharmaceutical intermediate, it is mainly used for the construction of molecular skeletons in new drug development and is widely used in the fields of pharmaceutical and chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |

![2-Oxa-6-azaspiro[3.5]nonane](https://img.chemicalbook.com/CAS/GIF/1046153-20-1.gif)

![5-Oxa-2-azaspiro[3.5]nonaneoxalate](https://img.chemicalbook.com/CAS/20150408/GIF/1427359-47-4.gif)
![tert-Butyl2,5-diazaspiro[3.5]nonane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/1246034-93-4.gif)
![1-Oxaspiro[2.5]octane-2-carbonitrile](https://img.chemicalbook.com/CAS/GIF/36929-66-5.gif)
![7-Oxa-1-azaspiro[4.4]nonanehydrochloride](https://img.chemicalbook.com/CAS/20150408/GIF/CB52667541.gif)
![Ethyl8-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylate](https://img.chemicalbook.com/CAS/20150408/GIF/24730-88-9.gif)