BD0766032
2-Chloro-6-nitrobenzoic acid , 98% , 5344-49-0
CAS NO.：5344-49-0
Empirical Formula: C7H4ClNO4
Molecular Weight: 201.56
MDL number: MFCD00100425
EINECS: 226-287-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB53.60 | In Stock |
|
| 25g | RMB91.20 | In Stock |
|
| 100g | RMB264.80 | In Stock |
|
| 500g | RMB932.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-166°C |
| Boiling point: | 345.7±27.0 °C(Predicted) |
| Density | 1.602±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pK1: 1.342 (25°C) |
| form | crystalline solid |
| color | Off-white to cream |
| BRN | 2694949 |
| InChI | InChI=1S/C7H4ClNO4/c8-4-2-1-3-5(9(12)13)6(4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | JYHOMEFOTKWQPN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C([N+]([O-])=O)C=CC=C1Cl |
| CAS DataBase Reference | 5344-49-0(CAS DataBase Reference) |
Description and Uses
2-Chloro-6-nitrobenzoic acid can be used in the synthesis of laquinimod intermediate 2-amino-6-chlorobenzoic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2916399090 |
