BD0767453
1,2-Bis(5-nitropyridin-2-yl)disulfane , 96% , 2127-10-8
Synonym(s):
Bis(5-nitro-2-pyridyl) disulfide;DTNP
CAS NO.:2127-10-8
Empirical Formula: C10H6N4O4S2
Molecular Weight: 310.31
MDL number: MFCD00006453
EINECS: 218-344-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB110.40 | In Stock |
|
| 250mg | RMB164.80 | In Stock |
|
| 1g | RMB350.40 | In Stock |
|
| 5g | RMB1024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-157 °C(lit.) |
| Boiling point: | 139°C (rough estimate) |
| Density | 1.6508 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store at RT. |
| form | solid |
| pka | -2.88±0.29(Predicted) |
| color | Brown |
| BRN | 305413 |
| InChI | InChI=1S/C10H6N4O4S2/c15-13(16)7-1-3-9(11-5-7)19-20-10-4-2-8(6-12-10)14(17)18/h1-6H |
| InChIKey | ROUFCTKIILEETD-UHFFFAOYSA-N |
| SMILES | S(C1=NC=C([N+]([O-])=O)C=C1)SC1=NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 2127-10-8(CAS DataBase Reference) |
Description and Uses
2,2′-Dithiobis(5-nitropyridine) was employed:
- as cysteine-activating reagent to study the NMR of G protein-coupled receptors
- in the deprotection assays for protected selenocysteine-containing peptides
- for deprotecting p-methoxybenzyl groups and acetamidomethyl groups from the side-chains of cysteine and selenocysteine
- to remove the p-methoxybenzyl protecting group from cysteine and selenocysteine side-chains
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39 |
| WGK Germany | 3 |
| RTECS | UT2964000 |
| HS Code | 2933399990 |






