BD0771153
Tripropylorthoformate , 95% , 621-76-1
CAS NO.:621-76-1
Empirical Formula: C10H22O3
Molecular Weight: 190.28
MDL number: MFCD00015214
EINECS: 210-704-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB115.20 | In Stock |
|
| 25g | RMB412.00 | In Stock |
|
| 100g | RMB1480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 106-108 °C/40 mmHg (lit.) |
| Density | 0.883 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 162 °F |
| form | Liquid |
| Specific Gravity | 0.883 |
| color | Clear colorless |
| Sensitive | Moisture Sensitive |
| BRN | 1744249 |
| InChI | InChI=1S/C10H22O3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | RWNXXQFJBALKAX-UHFFFAOYSA-N |
| SMILES | C(OCCC)(OCCC)OCCC |
| CAS DataBase Reference | 621-76-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Tripropyl orthoformate(621-76-1) |
| EPA Substance Registry System | Tripropyl orthoformate (621-76-1) |
Description and Uses
Tripropoxymethane can be used in the lipase-?catalyzed esterification aimed at the kinetic resolution of racemic acids, circumventing the adverse effects of the water formed in the course of the reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | 1993 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Excepted Quantities | Non-Hazardous |




