BD0781732
(R)-1-((4-Chlorophenyl)(phenyl)methyl)piperazine , 95% , 300543-56-0
CAS NO.:300543-56-0
Empirical Formula: C17H19ClN2
Molecular Weight: 286.8
MDL number: MFCD11519277
EINECS: 608-439-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB40.00 | In Stock |
|
| 1g | RMB97.60 | In Stock |
|
| 5g | RMB300.80 | In Stock |
|
| 10g | RMB504.80 | In Stock |
|
| 25g | RMB1014.40 | In Stock |
|
| 100g | RMB2699.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-93oC |
| Boiling point: | 409.1±0.0 °C(Predicted) |
| Density | 1.158 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| pka | 8.99±0.10(Predicted) |
| form | Solid |
| color | White |
| PH | 9.38 at 25℃ and 10.07g/L |
| Water Solubility | Soluble in chloroform, methanol, and dichloromethane. Slightly soluble in water. |
| InChI | InChI=1/C17H19ClN2/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20/h1-9,17,19H,10-13H2/t17-/s3 |
| InChIKey | UZKBSZSTDQSMDR-SCBJWRGWNA-N |
| SMILES | [C@@H](N1CCNCC1)(C1C=CC=CC=1)C1C=CC(Cl)=CC=1 |&1:0,r| |
| CAS DataBase Reference | 300543-56-0 |
Description and Uses
(R)-1-[alpha-(4-Chlorophenyl)benzyl]piperazine intermediate in the production of (R)-Cetirizine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2933599550 |







