BD0788932
(1,5-Cyclooctadiene)(pyridine)(tricyclohexylphosphine)-iridium(I) hexafluorophosphate , 97% , 64536-78-3
Synonym(s):
(1,5-Cyclooctadiene)(pyridine)(tricyclohexylphosphine)-Ir(I) PF6;[Ir(cod)(PCy3)(py)]PF6;[Ir(cod)(PCy3)(py)]PF6;Crabtree’s catalyst;Iridium(I) hexafluorophosphate (1,5-Cyclooctadiene)-(pyridine)-(tricyclohexylphosphine) complex
CAS NO.:64536-78-3
Empirical Formula: C31H47F6IrNP2
Molecular Weight: 801.88
MDL number: MFCD00075097
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB125.60 | In Stock |
|
| 250mg | RMB236.80 | In Stock |
|
| 1g | RMB759.20 | In Stock |
|
| 5g | RMB3102.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C (dec.)(lit.) |
| Density | 1.67 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | Crystalline Powder |
| color | Orange |
| Water Solubility | Slightly soluble in acetone, dichloromethane, ethanol and diethyl ether. Insoluble in water. |
| Sensitive | Moisture Sensitive |
| Merck | 13,2594 |
| InChIKey | FGUUESBBRSXAAN-UHFFFAOYSA-O |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].P(C1CCCCC1)(C1CCCCC1)(C1CCCCC1)[Ir+]123(N4=CC=CC=C4)C4CCC1=C2CCC3=4 |
Description and Uses
1,5-Cyclooctadiene(pyridine)(tricyclohexylphosphine)iridium(I) hexafluorophosphate is used as a catalyst for hydrogenation of mono-, di-, tri-, and tetra-substituted substrates and the isomerization and hydroboration of alkenes. It is also used in isotope exchange reactions, especially the direct exchange of a hydrogen atom with its isotopes deuterium and tritium. Carbonyl groups are also known to direct the hydrogenation by the Crabtree catalyst is highly regioselective.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



