BD0800348
N-Methyl-1-imidazolecarboxamide , 95% , 72002-25-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB109.60 | In Stock |
|
| 1g | RMB268.80 | In Stock |
|
| 5g | RMB934.40 | In Stock |
|
| 10g | RMB1601.60 | In Stock |
|
| 25g | RMB3356.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-115°C |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | 10.18±0.46(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C5H7N3O/c1-6-5(9)8-3-2-7-4-8/h2-4H,1H3,(H,6,9) |
| InChIKey | CWUCFKUUTSQSSZ-UHFFFAOYSA-N |
| SMILES | C1N(C(NC)=O)C=CN=1 |
Description and Uses
N-Methyl-1H-imidazole-1-carboxamide is a useful Methyl Isocyanate (MIC) substitute.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
