BD0801745
1-Methyl-2-(methylthio)imidazole , 97% , 14486-52-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB181.60 | In Stock |
|
| 1g | RMB453.60 | In Stock |
|
| 5g | RMB1463.20 | In Stock |
|
| 10g | RMB2441.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 166 °C(Press: 30 Torr) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.88±0.25(Predicted) |
| color | Clear Colourless |
| InChI | InChI=1S/C5H8N2S/c1-7-4-3-6-5(7)8-2/h3-4H,1-2H3 |
| InChIKey | LKIVEIAXFZBGMO-UHFFFAOYSA-N |
| SMILES | C1(SC)N(C)C=CN=1 |
Description and Uses
1-Methyl-2-(methylthio)imidazole (Methimazole USP Related Compound C) is an impurity of Methimazole (M260300), a thiourea antithyroid agent that prevents iodine organification, thus inhibiting the synthesis of thyroxine.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319-H361fd |
| Precautionary statements | P202-P280-P301+P312-P302+P352-P305+P351+P338-P308+P313 |
| HS Code | 2933290000 |