BD0802345
2-[4-(Pyrimidin-2-yl)piperazin-1-yl]pyrimidine , 95% , 84746-24-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB934.40 | In Stock |
|
| 250mg | RMB1398.40 | In Stock |
|
| 1g | RMB3494.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 273-274 °C |
| Boiling point: | 480.7±55.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly, Heated) |
| form | Solid |
| pka | 5.17±0.33(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C12H14N6/c1-3-13-11(14-4-1)17-7-9-18(10-8-17)12-15-5-2-6-16-12/h1-6H,7-10H2 |
| InChIKey | CGDIIYVMINKXRL-UHFFFAOYSA-N |
| SMILES | N2(CCN(CC2)c3ncccn3)c1ncccn1 |
Description and Uses
2,2’-(1,4-Piperazinediyl)bis-pyrimidine is an impurity of Buspirone (B689850), an non-benzodiazepine anxiolytic; 5-hydroxytryptamine (5-HT1) receptor agonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933599550 |
| Storage Class | 11 - Combustible Solids |

![2-[4-(Pyrimidin-2-yl)piperazin-1-yl]pyrimidine](https://img.chemicalbook.com/CAS/GIF/84746-24-7.gif)



![8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione](https://img.chemicalbook.com/CAS/GIF/21098-11-3.gif)

