BD0805432
2-Hydroxy-3-nitrobenzaldehyde , 98% , 5274-70-4
Synonym(s):
3-Nitrosalicylaldehyde
CAS NO.:5274-70-4
Empirical Formula: C7H5NO4
Molecular Weight: 167.12
MDL number: MFCD00041874
EINECS: 226-098-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB223.20 | In Stock |
|
| 1g | RMB557.60 | In Stock |
|
| 5g | RMB1949.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-109 °C(lit.) |
| Boiling point: | 295.67°C (rough estimate) |
| Density | 1.5216 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 5.07±0.24(Predicted) |
| form | Crystalline Powder |
| color | Yellow to brown |
| Water Solubility | slightly soluble |
| Sensitive | Air Sensitive |
| InChI | 1S/C7H5NO4/c9-4-5-2-1-3-6(7(5)10)8(11)12/h1-4,10H |
| InChIKey | NUGOTBXFVWXVTE-UHFFFAOYSA-N |
| SMILES | Oc1c(C=O)cccc1[N+]([O-])=O |
| CAS DataBase Reference | 5274-70-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 2-hydroxy-3-nitro-(5274-70-4) |
| EPA Substance Registry System | Benzaldehyde, 2-hydroxy-3-nitro- (5274-70-4) |
Description and Uses
2-Hydroxy-3-nitrobenzaldehyde may be used in the synthesis of 5-acetyl-4-aryl-6-methyl-1,2,3,4-tetrahydro pyrimidine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




