BD0807145
4-Bromo-2-(trifluoromethyl)benzene-1-sulfonylchloride , 96% , 176225-10-8
CAS NO.：176225-10-8
Empirical Formula: C7H3BrClF3O2S
Molecular Weight: 323.51
MDL number: MFCD03094392
| Pack Size | Price | Stock | Quantity |
| 5g | RMB145.60 | In Stock |
|
| 10g | RMB271.20 | In Stock |
|
| 25g | RMB429.60 | In Stock |
|
| 100g | RMB1688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-58 °C (lit.) |
| Boiling point: | 285.6±40.0 °C(Predicted) |
| Density | 1.840±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystalline powder |
| color | Faint yellow to light orange |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H3BrClF3O2S/c8-4-1-2-6(15(9,13)14)5(3-4)7(10,11)12/h1-3H |
| InChIKey | YFXYEMZYOMNQLD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Br)ccc1S(Cl)(=O)=O |
| CAS DataBase Reference | 176225-10-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H314 |
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P405-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
