BD0809232
                    2,2-Dimethyl-4-oxo-3,8,11,14-tetraoxa-5-azahexadecan-16-oic acid , 97% , 462100-06-7
| Pack Size | Price | Stock | Quantity | 
| 100mg | RMB152.00 | In Stock | 
                                                 | 
                                        
| 250mg | RMB242.40 | In Stock | 
                                                 | 
                                        
| 1g | RMB395.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB1589.60 | In Stock | 
                                                 | 
                                        
| 25g | RMB7834.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 460.1±35.0 °C(Predicted) | 
                                    
| Density | 1.141±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | -20°C | 
                                    
| solubility | DMF: 5 mg/ml,DMSO: 1 mg/ml,Ethanol: 30 mg/ml | 
                                    
| form | A neat oil | 
                                    
| pka | 3.39±0.10(Predicted) | 
                                    
| color | Colorless to light yellow | 
                                    
| InChI | InChI=1S/C13H25NO7/c1-13(2,3)21-12(17)14-4-5-18-6-7-19-8-9-20-10-11(15)16/h4-10H2,1-3H3,(H,14,17)(H,15,16) | 
                                    
| InChIKey | IFSMYFLQPDFUOI-UHFFFAOYSA-N | 
                                    
| SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCOCC(O)=O | 
                                    
| CAS DataBase Reference | 462100-06-7 | 
                                    
Description and Uses
t-Boc-N-amido-PEG3-CH2CO2H is a PEG linker containing a terminal carboxylic acid and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine.
This is a crosslinker with a t-Boc protected amine on one end and a carboxyl group on the other end. The compound contains three PEG units to help improve solubility.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| HS Code | 2924190090 | 







