BD0814245
4-(tert-Butyl)-2-nitrophenol , 98% , 3279-07-0
CAS NO.:3279-07-0
Empirical Formula: C10H13NO3
Molecular Weight: 195.22
MDL number: MFCD00191888
EINECS: 221-914-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB75.20 | In Stock |
|
| 5g | RMB167.20 | In Stock |
|
| 25g | RMB399.20 | In Stock |
|
| 100g | RMB1414.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-29 °C(lit.) |
| Boiling point: | 97 °C1 mm Hg(lit.) |
| Density | 1.12 g/mL at 25 °C(lit.) |
| refractive index | 1.5500-1.5530 |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Yellow to Dark Yellow Oil to Semi-Solid |
| pka | 7.37±0.14(Predicted) |
| color | Orange to Brown |
| Stability: | Hygroscopic |
| InChI | 1S/C10H13NO3/c1-10(2,3)7-4-5-9(12)8(6-7)11(13)14/h4-6,12H,1-3H3 |
| InChIKey | IHGNADPMUSNTJW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 3279-07-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Tert-butyl-2-nitrophenol(3279-07-0) |
| EPA Substance Registry System | Phenol, 4-(1,1-dimethylethyl)-2-nitro- (3279-07-0) |
Description and Uses
4-tert-Butyl-2-nitrophenol may be used for the preparation of (2-hydroxy-3-nitro-5-tert-butylbenzyl)trimethylammonium iodide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







