BD0820545
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-diphenylpropanoicacid , 97%HPLC , 201484-50-6
Synonym(s):
N-(9-Fluorenylmethoxycarbonyl)-β-phenyl-L -phenylalanine;Fmoc-β,β-diphenyl-Ala-OH;Fmoc-3,3-diphenyl-L -alanine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB88.80 | In Stock |
|
| 1g | RMB350.40 | In Stock |
|
| 5g | RMB1229.60 | In Stock |
|
| 25g | RMB5092.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-129 °C(lit.) |
| Boiling point: | 676.5±55.0 °C(Predicted) |
| alpha | -12 º (c=1 in chloroform) |
| Density | 1.262±0.06 g/cm3(Predicted) |
| Flash point: | 63 °C |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.57±0.10(Predicted) |
| color | White to off-white |
| BRN | 8873562 |
| Major Application | peptide synthesis |
| InChIKey | PENQOTJCVODUQU-NDEPHWFRSA-N |
| SMILES | OC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(c4ccccc4)c5ccccc5 |
| CAS DataBase Reference | 201484-50-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H400-H410 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N,Xi |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HazardClass | 9 |
| HS Code | 2922498590 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
