BD0836232
(Dimethoxy(methyl)silyl)methyl methacrylate , 95%+(stabilizedwithBHT) , 121177-93-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB72.00 | In Stock |
|
| 25g | RMB251.20 | In Stock |
|
| 100g | RMB826.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-100°C |
| Boiling point: | 205°C |
| Density | 1,019 g/cm3 |
| refractive index | 1.4274 |
| Flash point: | 88°C |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| Specific Gravity | 1.020 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C8H16O4Si/c1-6(2)7(9)12-5-13-8(10-3)11-4/h8H,1,5,13H2,2-4H3 |
| InChIKey | SLRFSMGNUQIIOH-UHFFFAOYSA-N |
| SMILES | C(OC[SiH2]C(OC)OC)(=O)C(C)=C |
| EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, (dimethoxymethylsilyl)methyl ester (121177-93-3) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Safety Statements | 23-24/25 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9051 |
