BD0841832
1-Hydroxy-2,1-benzoxaborolane , 98% , 5735-41-1
Synonym(s):
1,3-Dihydro-1-hydroxy-2,1-benzoxaborole;2-(Hydroxymethyl)phenylboronic acid hemiester
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.80 | In Stock |
|
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB152.80 | In Stock |
|
| 10g | RMB295.20 | In Stock |
|
| 25g | RMB717.60 | In Stock |
|
| 100g | RMB2708.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-100 °C |
| Boiling point: | 237.2±43.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 7.01±0.20(Predicted) |
| color | White to Almost white |
| BRN | 4333 |
| InChI | InChI=1S/C7H7BO2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4,9H,5H2 |
| InChIKey | XOQABDOICLHPIS-UHFFFAOYSA-N |
| SMILES | B1(O)C2=CC=CC=C2CO1 |
| CAS DataBase Reference | 5735-41-1(CAS DataBase Reference) |
Description and Uses
Oxaboroles and benzoxaboroles are useful substrates to prepare allylic and benzylic alcohols via Suzuki coupling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29349990 |
