BD0848032
(R)-4-(tert-Butoxycarbonyl)morpholine-2-carboxylic acid , 95% , 884512-77-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB100.00 | In Stock |
|
| 250mg | RMB184.80 | In Stock |
|
| 1g | RMB238.40 | In Stock |
|
| 5g | RMB1056.80 | In Stock |
|
| 10g | RMB2040.80 | In Stock |
|
| 25g | RMB4860.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-150°C |
| Boiling point: | 369.5±42.0 °C(Predicted) |
| Density | 1.230 |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 3.25±0.20(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C10H17NO5/c1-10(2,3)16-9(14)11-4-5-15-7(6-11)8(12)13/h7H,4-6H2,1-3H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | LGWMTRPJZFEWCX-SSDOTTSWSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCO[C@@H](C(O)=O)C1 |
Description and Uses
(2R)-4-(1,1-Dimethylethyl) Ester 2,4-Morpholinedicarboxylic Acid is used in the preparation of renin inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2934999090 |
