BD0848732
(R)-4-Chloro-alpha-methylbenzyl Alcohol , 95% , 75968-40-0
Synonym(s):
(R)-1-(4-Chlorophenyl)ethanol
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB54.40 | In Stock |
|
| 250mg | RMB72.80 | In Stock |
|
| 1g | RMB276.80 | In Stock |
|
| 5g | RMB1063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 49 º (C=1.6 IN CHLOROFORM) |
| Boiling point: | 240.6±15.0 °C(Predicted) |
| Density | 1.158 g/mL at 25 °C |
| refractive index | n20/D 1.544 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| pka | 14.22±0.20(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]20/D +49.0°, c = 1.6 in chloroform |
| InChI | InChI=1/C8H9ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 |
| InChIKey | MVOSNPUNXINWAD-ISZMHOAENA-N |
| SMILES | C1([C@@H](C)O)C=CC(=CC=1)Cl |&1:1,r| |
Description and Uses
(R)-4-Chloro-α-methylbenzyl alcohol can be used:
- As a substrate in the racemization process of secondary alcohols using ruthenium hydroxide complexes.
- In the synthesis of 2,3,4,9-tetrahydro-1H-carbazole as potent DP1 antagonists.
- As a substrate in the synthesis of chiral 3-aryl-3-substituted propanoic acids through Mitsunobu reaction.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-41-52/53 |
| Safety Statements | 26-39-61 |
| WGK Germany | 3 |
| HS Code | 2906290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |








