BD0849732
(S)-2-((tert-Butoxycarbonyl)amino)-3-(perfluorophenyl)propanoic acid , 98% , 34702-60-8
Synonym(s):
(S)-2-(Boc-amino)-3-(pentafluorophenyl)propionic acid
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB124.80 | In Stock |
|
| 250mg | RMB187.20 | In Stock |
|
| 1g | RMB467.20 | In Stock |
|
| 5g | RMB1632.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 411.1±45.0 °C(Predicted) |
| Density | 1.422±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.70±0.20(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C14H14F5NO4/c1-14(2,3)24-13(23)20-6(12(21)22)4-5-7(15)9(17)11(19)10(18)8(5)16/h6H,4H2,1-3H3,(H,20,23)(H,21,22)/t6-/m0/s1 |
| InChIKey | UZDKQMIDSLETST-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c(F)c(F)c(F)c(F)c1F)C(O)=O |
| CAS DataBase Reference | 34702-60-8(CAS DataBase Reference) |
Description and Uses
BOC-L-Pentafluorophenylalanine is an intermediate used in the self-assembly of tripeptides into functional coating material that resists biofouling.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
