BD0853448
(2-Butylbenzofuran-3-yl)(4-hydroxy-3,5-diiodophenyl)methanone , 98% , 1951-26-4
Synonym(s):
(2-Butylbenzofuran-3-yl)(4-hydroxy-3,5-diiodophenyl)methanone;NSC 85437
CAS NO.:1951-26-4
Empirical Formula: C19H16I2O3
Molecular Weight: 546.14
MDL number: MFCD02675787
EINECS: 217-773-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB458.40 | In Stock |
|
| 1g | RMB1034.40 | In Stock |
|
| 5g | RMB3103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-144°C |
| Boiling point: | 536.8±50.0 °C(Predicted) |
| Density | 1.864 |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 4.84±0.25(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C19H16I2O3/c1-2-3-7-16-17(12-6-4-5-8-15(12)24-16)18(22)11-9-13(20)19(23)14(21)10-11/h4-6,8-10,23H,2-3,7H2,1H3 |
| InChIKey | PNFMEGSMKIHDFZ-UHFFFAOYSA-N |
| SMILES | C(C1C2=CC=CC=C2OC=1CCCC)(C1=CC(I)=C(O)C(I)=C1)=O |
| CAS DataBase Reference | 1951-26-4(CAS DataBase Reference) |
Description and Uses
2-Butyl-3-(3,5-diiodo-4-hydroxybenzoyl)benzofuran (Amiodarone EP Impurity D) is a related compound of Amiodarone, a non-selective ion channel blocker.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2932996560 |




