BD0854032
Boc-L-Homoserine lactone , 98% , 40856-59-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB129.60 | In Stock |
|
| 10g | RMB251.20 | In Stock |
|
| 25g | RMB591.20 | In Stock |
|
| 100g | RMB2202.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-126 °C |
| Boiling point: | 363.7±31.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 11.21±0.20(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C9H15NO4/c1-9(2,3)14-8(12)10-6-4-5-13-7(6)11/h6H,4-5H2,1-3H3,(H,10,12)/t6-/m0/s1 |
| InChIKey | IMWMFJMYEKHYKG-LURJTMIESA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@H]1CCOC1=O |
Description and Uses
(S)-(-)-α-(N-t-BOC-Amino)-γ-butyrolactone is used in the preparation of N-acyl homoserine lactones as interbacterial quorum signal modulators as antibacterial agents.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P260-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| HS Code | 2932209090 |




