BD0857032
(S)-1-(4-Fluorophenyl)ethanol , 97% , 101219-73-2
Synonym(s):
(S)-1-(4′-Fluorophenyl)ethanol
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB148.80 | In Stock |
|
| 250mg | RMB220.00 | In Stock |
|
| 1g | RMB635.20 | In Stock |
|
| 5g | RMB2392.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -49 º (C=1 IN CHLOROFORM) |
| Boiling point: | 216.2±0.0 °C(Predicted) |
| Density | 1.111 g/mL at 25 °C |
| refractive index | n20/D 1.502 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.36±0.20(Predicted) |
| form | liquid |
| color | Clear |
| optical activity | [α]20/D -49.0°, c = 1 in chloroform |
| InChI | InChI=1/C8H9FO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 |
| InChIKey | PSDSORRYQPTKSV-ISZMHOAENA-N |
| SMILES | C1(=CC=C(F)C=C1)[C@@H](O)C |&1:7,r| |
| CAS DataBase Reference | 101219-73-2(CAS DataBase Reference) |
Description and Uses
(S)-4-Fluoro-α-methylbenzyl alcohol can be used as a starting material to synthesize a CCR5 antagonist named MLN1251.Along with its ortho- and non-fluorine substituted analogs, it can be used to study the role of fluorine substitution in chiral discrimination in molecular complexes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2906290090 |
