BD0861945
4,4-Dimethyldihydrofuran-2,3-dione , 95% , 13031-04-4
CAS NO.:13031-04-4
Empirical Formula: C6H8O3
Molecular Weight: 128.13
MDL number: MFCD00012331
EINECS: 235-891-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB72.00 | In Stock |
|
| 1g | RMB238.40 | In Stock |
|
| 5g | RMB1032.00 | In Stock |
|
| 25g | RMB4222.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-69 °C (lit.) |
| Boiling point: | 125-126℃ (15 Torr) |
| Density | 1.152±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | dichloromethane: soluble25mg/mL, clear, colorless to yellow |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C6H8O3/c1-6(2)3-9-5(8)4(6)7/h3H2,1-2H3 |
| InChIKey | HRTOQFBQOFIFEE-UHFFFAOYSA-N |
| SMILES | O1CC(C)(C)C(=O)C1=O |
Description and Uses
Dihydro-4,4-dimethyl-2,3-furandione is an activated keto compound and its enantioselective hydrogenation was reported. Neutral Rhodium (I) aminophosphine-phosphinite complex calatyzed asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione was reported. Asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione gives
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |





