BD0862645
2,5-Dimethoxybenzoicacid , 98% , 2785-98-0
CAS NO.:2785-98-0
Empirical Formula: C9H10O4
Molecular Weight: 182.17
MDL number: MFCD00002436
EINECS: 220-503-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.00 | In Stock |
|
| 5g | RMB102.40 | In Stock |
|
| 10g | RMB159.20 | In Stock |
|
| 25g | RMB344.00 | In Stock |
|
| 100g | RMB920.00 | In Stock |
|
| 500g | RMB2760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C (lit.) |
| Boiling point: | 275.56°C (rough estimate) |
| Density | 1.2481 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.97±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2097993 |
| InChI | InChI=1S/C9H10O4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | NYJBTJMNTNCTCP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=CC=C1OC |
| LogP | 1.281 (est) |
| CAS DataBase Reference | 2785-98-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2,5-dimethoxy-(2785-98-0) |
Description and Uses
2,5-Dimethoxybenzoic acid has been used in synthesis of:
- galbulimima alkaloid GB 13
- 3,4-dihydrofluoren-2(1H)-ones via reductive alkylation
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280g |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37-36 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



