BD0863648
2-Phenoxypropanoicacid , 98% , 940-31-8
CAS NO.：940-31-8
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00002643
EINECS: 213-370-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB74.40 | In Stock |
|
| 10g | RMB115.20 | In Stock |
|
| 25g | RMB229.60 | In Stock |
|
| 100g | RMB734.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-115 °C (lit.) |
| Boiling point: | 265 °C (lit.) |
| Density | 1.1708 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 265°C |
| storage temp. | Store at room temperature |
| pka | 3.22±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3198799 |
| InChI | InChI=1S/C9H10O3/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11) |
| InChIKey | SXERGJJQSKIUIC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=CC=C1)C |
| CAS DataBase Reference | 940-31-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2-phenoxy-(940-31-8) |
| EPA Substance Registry System | Propanoic acid, 2-phenoxy- (940-31-8) |
Description and Uses
2-Phenoxypropionic Acid is used in organic chemistry reduction reactions. Used in the synthesis of PPAR (peroxisome proliferator-activated receptor (PPAR) ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 24/25-45-36/37/39-27-26 |
| WGK Germany | 1 |
| RTECS | UF6515000 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
