BD0872153
                    2-(4-(tert-Butyl)phenoxy)aceticacid , 95+% , 1798-04-5
                            Synonym(s):
[4-(1,1-Dimethylethyl)phenoxy]-acetic acid;TAC acid
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 1g | RMB92.80 | In Stock | 
                                                 | 
                                        
| 5g | RMB327.20 | In Stock | 
                                                 | 
                                        
| 25g | RMB1125.60 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 96 °C(lit.) | 
                                    
| Boiling point: | 325.4±25.0 °C(Predicted) | 
                                    
| Density | 1.088±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Storage temp. 2-8°C | 
                                    
| solubility | Sparingly Soluble (0.56 g/L) (25°C), Calc. | 
                                    
| pka | 3.22±0.10(Predicted) | 
                                    
| Appearance | Off-white to light yellow Solid | 
                                    
| BRN | 2368208 | 
                                    
| InChI | InChI=1S/C12H16O3/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h4-7H,8H2,1-3H3,(H,13,14) | 
                                    
| InChIKey | FBIGAJNVRFKBJL-UHFFFAOYSA-N | 
                                    
| SMILES | C(O)(=O)COC1=CC=C(C(C)(C)C)C=C1 | 
                                    
| CAS DataBase Reference | 1798-04-5(CAS DataBase Reference) | 
                                    
Description and Uses
Applied as a reagent for the TAC protective group in nucleosides.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36/37/39 | 
| WGK Germany | 3 | 
| HazardClass | IRRITANT | 



![O(1),O(3)-Bis(ethoxycarbonylmethyl)-p-tert-butylcalix[4]arene](https://img.chemicalbook.com/CAS/GIF/97600-49-2.gif)



![O(1),O(3)-Bis(carboxymethyl)-O(2),O(4)-dimethyl-p-tert-butylcalix[4]arene](https://img.chemicalbook.com/CAS/GIF/136157-98-7.gif)