BD0879932
1-Isobutyl-1H-imidazo[4,5-c]quinoline , 95% , 99010-24-9
Synonym(s):
1-Isobutyl-1H-imidazo[4,5-c]quinoline
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB447.20 | In Stock |
|
| 250mg | RMB715.20 | In Stock |
|
| 1g | RMB1788.00 | In Stock |
|
| 5g | RMB5716.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95℃ |
| Boiling point: | 402.6±37.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 5.34±0.30(Predicted) |
| Appearance | Off-white to gray Solid |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C14H15N3/c1-10(2)8-17-9-16-13-7-15-12-6-4-3-5-11(12)14(13)17/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | CXYOCSTZCULCAE-UHFFFAOYSA-N |
| SMILES | [n]1(c2c(nc1)cnc3c2cccc3)CC(C)C |
| CAS DataBase Reference | 99010-24-9(CAS DataBase Reference) |
Description and Uses
Desamino Imiquimod is a pharmacologically active compound related to Imiquimod (I475000), an immune response modifier. It stimulates the production of Interferon-a.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |

![1-Isobutyl-1H-imidazo[4,5-c]quinoline](https://img.chemicalbook.com/CAS/GIF/99010-24-9.gif)

![4-Chloro-1-(2-methylpropyl)-1H-imidazo[4,5-c]quinoline](https://img.chemicalbook.com/CAS/20180906/GIF/99010-64-7.gif)

![1-Propyl-1H-imidazo[4,5-c]quinolin-4-amine](https://img.chemicalbook.com/CAS/20180808/GIF/853792-81-1.gif)
![1H-Imidazo[4,5-c]quinoline,1-(2-methylpropyl)-,5-oxide](https://img.chemicalbook.com/CAS/20150408/GIF/99010-63-6.gif)