BD0889532
1-(p-Tolyl)cyclopropanecarboxylic acid , 98% , 83846-66-6
CAS NO.:83846-66-6
Empirical Formula: C11H12O2
Molecular Weight: 176.21
MDL number: MFCD00066918
EINECS: 281-043-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB83.20 | In Stock |
|
| 1g | RMB207.20 | In Stock |
|
| 5g | RMB709.60 | In Stock |
|
| 10g | RMB1204.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109 °C |
| Boiling point: | 267.83°C (rough estimate) |
| Density | 1.0558 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 4.39±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C11H12O2/c1-8-2-4-9(5-3-8)11(6-7-11)10(12)13/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | AYUGAOYMYXSOKU-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C)C=C2)(C(O)=O)CC1 |
Description and Uses
1-(4-Methylphenyl)-1-cyclopropanecarboxylic Acid can be used formyl peptide 2 receptor and formyl peptide 1 receptor agonists
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| HS Code | 29163900 |







