PRODUCT Properties
| Melting point: | 90-91 |
| Boiling point: | 258.0±20.0 °C(Predicted) |
| Density | 1.415±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.80±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C6H5FO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H |
| InChIKey | NFWGQJUHSAGJBE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1O |
| CAS DataBase Reference | 367-32-8(CAS DataBase Reference) |
Description and Uses
4-Fluorocatechol is mainly used in the production of pesticides and pharmaceutical intermediates. For example, the latest insecticides abroad are made from it through processes such as ketalization.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Hazard Codes | Xi |
| RIDADR | 2923 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 2909309090 |
| Limited Quantities | 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




