BD0901032
1,1,4,4,6-Pentamethyl-1,2,3,4-tetrahydronaphthalene , 97% , 6683-48-3
CAS NO.：6683-48-3
Empirical Formula: C15H22
Molecular Weight: 202.34
MDL number: MFCD00833394
EINECS: 229-724-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 10g | RMB93.60 | In Stock |
|
| 25g | RMB179.20 | In Stock |
|
| 100g | RMB616.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31 |
| Boiling point: | 60-64°C 0,2mm |
| Density | 0.882±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | Colourless to Pale Yellow Oil |
| InChI | InChI=1S/C15H22/c1-11-6-7-12-13(10-11)15(4,5)9-8-14(12,2)3/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | AISXBZVAYNUAKB-UHFFFAOYSA-N |
| SMILES | C1(C)(C)C2=C(C=C(C)C=C2)C(C)(C)CC1 |
Description and Uses
Targretin analog, has been shown to induce apoptosis in certain leukemia cell lines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2917399590 |
