BD0920253
(2R,3S,4S,5S)-5-(Acetoxymethyl)tetrahydrofuran-2,3,4-triyltriacetate , 97% , 144490-03-9
Synonym(s):
1,2,3,5-Tetra-O-acetyl-β-L -ribofuranose
| Pack Size | Price | Stock | Quantity |
| 1g | RMB161.60 | In Stock |
|
| 5g | RMB539.20 | In Stock |
|
| 25g | RMB1888.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-83 °C |
| Boiling point: | 385.6±42.0 °C(Predicted) |
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly), Methanol (Slightly), Pyridine (Slightly) |
| form | Powder |
| color | White to Off-white |
| optical activity | [α]20/D +12.5±0.5°, c = 2.4% in chloroform |
| InChI | InChI=1/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11+,12+,13+/s3 |
| InChIKey | IHNHAHWGVLXCCI-RVLAKFOANA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@H](COC(=O)C)O[C@@H](OC(=O)C)[C@@H]1OC(=O)C |&1:0,5,12,17,r| |
| CAS DataBase Reference | 144490-03-9(CAS DataBase Reference) |
Description and Uses
1,2,3,5-Tetra-O-acetyl β-L-Ribofuranose is an isomer of 1,2,3,5-Tetra-O-acetyl β-D-Ribofuranose (T283100) which is used in the synthesis of 3-(β-D-ribofuranosyl)-2,3-dihydro-6H-1,3-oxazine-2,6-dione, a new pyrimidine nucleoside analog related to uridine.
Safety
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |






