BD0944932
4,7-Dichloroisobenzofuran-1,3-dione , 98% , 4466-59-5
Synonym(s):
4,7-Dichloroisobenzofuran-1,3-dione
CAS NO.:4466-59-5
Empirical Formula: C8H2Cl2O3
Molecular Weight: 217.01
MDL number: MFCD00042786
EINECS: 224-733-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB137.60 | In Stock |
|
| 250mg | RMB277.60 | In Stock |
|
| 1g | RMB575.20 | In Stock |
|
| 5g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C(lit.) |
| Boiling point: | 339.1°C (rough estimate) |
| Density | 1.5974 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| BRN | 164697 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C8H2Cl2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H |
| InChIKey | HEGLMCPFDADCAQ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c2C(=O)OC(=O)c12 |
| CAS DataBase Reference | 4466-59-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,6-Dichloro-phthalic anhydride(4466-59-5) |
Description and Uses
3,6-Dichlorophthalic Anhydride is an intermediate in the synthesis of phthalic compounds, phthalazines, and quinones with antimicrobial activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





