BD0950832
Benzyl (3-fluoro-4-(6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl)phenyl)carbamate , 97% , 1220910-89-3
CAS NO.:1220910-89-3
Empirical Formula: C21H17FN6O2
Molecular Weight: 404.4
MDL number: MFCD22418002
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB115.20 | In Stock |
|
| 1g | RMB288.00 | In Stock |
|
| 5g | RMB920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170°C |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 12.52±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C21H17FN6O2/c1-28-26-20(25-27-28)19-10-7-15(12-23-19)17-9-8-16(11-18(17)22)24-21(29)30-13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,24,29) |
| InChIKey | GIBJIBYBOVNDET-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)NC1=CC=C(C2=CC=C(C3=NN(C)N=N3)N=C2)C(F)=C1 |
Description and Uses
N-[3-Fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]phenyl]carbamic Acid Phenylmethyl Ester is an intermediate in the synthesis of Tedizolid (T013750), an known oral and intravenous antibiotic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P501-P270-P264-P301+P312+P330 |






