BD0957532
Quinuclidin-3-yl acetate , 98% , 827-61-2
CAS NO.：827-61-2
Empirical Formula: C9H15NO2
Molecular Weight: 169.22
MDL number: MFCD00468105
EINECS: 212-574-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB174.40 | In Stock |
|
| 250mg | RMB288.00 | In Stock |
|
| 1g | RMB478.40 | In Stock |
|
| 5g | RMB1869.60 | In Stock |
|
| 10g | RMB3430.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 298.52°C (rough estimate) |
| Density | 1.0873 (rough estimate) |
| refractive index | 1.4780 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | <34°C Solid,>36°C Liquid |
| pka | 9.22±0.33(Predicted) |
| color | Off-white to light yellow |
| InChI | InChI=1S/C9H15NO2/c1-7(11)12-9-6-10-4-2-8(9)3-5-10/h8-9H,2-6H2,1H3 |
| InChIKey | WRJPSSPFHGNBMG-UHFFFAOYSA-N |
| SMILES | N12CCC(CC1)C(OC(=O)C)C2 |
Description and Uses
analgesic (topical), depletes Substance P, neurotoxic
Safety
| Toxicity | LD50 scu-rat: 225 mg/kg ARZNAD 18,320,68 |
