BD0957832
1-Benzhydryl-3-iodoazetidine , 98% , 125735-40-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB366.40 | In Stock |
|
| 1g | RMB757.60 | In Stock |
|
| 5g | RMB2604.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101~102℃ |
| Boiling point: | 377℃ |
| Density | 1.55 |
| Flash point: | 182℃ |
| storage temp. | 2-8°C(protect from light) |
| pka | 6.16±0.10(Predicted) |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C16H16IN/c17-15-11-18(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | IBCVAYQWXMWFLD-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(I)C1 |
Description and Uses
1-Benzhydryl-3-iodoazetidine is a useful research reagent used in the synthetic preparation of other pharmacologically active molecules.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933998090 |







![[1-(diphenylmethyl)azetidin-3-yl]methanamine](https://img.chemicalbook.com/CAS/GIF/36476-88-7.gif)