BD0964932
1-(2,4-Dichloro-5-fluorophenyl)ethanone , 98% , 704-10-9
CAS NO.:704-10-9
Empirical Formula: C8H5Cl2FO
Molecular Weight: 207.03
MDL number: MFCD00077499
EINECS: 615-113-6
| Pack Size | Price | Stock | Quantity |
| 10g | RMB29.60 | In Stock |
|
| 25g | RMB39.20 | In Stock |
|
| 100g | RMB139.20 | In Stock |
|
| 500g | RMB608.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33-36 °C |
| Boiling point: | 167 °C(lit.) |
| Density | 1.425 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Specific Gravity | 1.425 |
| BRN | 3090042 |
| InChI | InChI=1S/C8H5Cl2FO/c1-4(12)5-2-8(11)7(10)3-6(5)9/h2-3H,1H3 |
| InChIKey | FAKJFAMIABOKBW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(F)=C(Cl)C=C1Cl)C |
| CAS DataBase Reference | 704-10-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




