BD0980253
Dicyclohexyl(phenyl)phosphine , 98% , 6476-37-5
Synonym(s):
Phenyldicyclohexylphosphine
CAS NO.:6476-37-5
Empirical Formula: C18H27P
Molecular Weight: 274.38
MDL number: MFCD00003854
EINECS: 229-334-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB84.80 | In Stock |
|
| 250mg | RMB143.20 | In Stock |
|
| 1g | RMB386.40 | In Stock |
|
| 5g | RMB1351.20 | In Stock |
|
| 25g | RMB4728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-61 °C (lit.) |
| Boiling point: | 391.8±11.0 °C(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C18H27P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11,17-18H,2-3,6-9,12-15H2 |
| InChIKey | VPLLTGLLUHLIHA-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)(C1CCCCC1)C1=CC=CC=C1 |
| CAS DataBase Reference | 6476-37-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Dicyclohexylphenylphosphine(6476-37-5) |
| EPA Substance Registry System | Phosphine, dicyclohexylphenyl- (6476-37-5) |
Description and Uses
Dicyclohexylphenylphosphine is an organic phosphine compound, which can be used as a raw material for organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302 |
| Precautionary statements | P280f-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | SY9125000 |
| TSCA | TSCA listed |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






