BD0999032
1-Indanecarboxylic acid , 98% , 14381-42-1
CAS NO.：14381-42-1
Empirical Formula: C10H10O2
Molecular Weight: 162.19
MDL number: MFCD00021239
EINECS: 238-355-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB53.60 | In Stock |
|
| 250mg | RMB70.40 | In Stock |
|
| 1g | RMB276.80 | In Stock |
|
| 5g | RMB989.60 | In Stock |
|
| 10g | RMB1829.60 | In Stock |
|
| 25g | RMB3540.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| Boiling point: | 324.6±21.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| Melting point: | 59-60 °C |
| pka | 4.23±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H10O2/c11-10(12)9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2,(H,11,12) |
| InChIKey | JBQMFBWTKWOSQX-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)C2=C(C=CC=C2)CC1 |
Description and Uses
1-Indanecarboxylic acid is an organic intermediate compound used in the preparation of 1-indanecarbonitrile, 6-Chloroindan-1-carboxylic acid and 6-Bromo-2,3-dihydro-1H-indene-1-carboxylic acid, among other chemical products.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 2916200090 |
