BD1019532
[2,2'-Bipyridine]-4,4'-dicarbaldehyde , 98% , 99970-84-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB209.60 | In Stock |
|
| 250mg | RMB376.80 | In Stock |
|
| 1g | RMB669.60 | In Stock |
|
| 5g | RMB2209.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188 °C (dec.)(lit.) |
| Boiling point: | 434.4±45.0 °C(Predicted) |
| Density | 1.289±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.03±0.30(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C12H8N2O2/c15-7-9-1-3-13-11(5-9)12-6-10(8-16)2-4-14-12/h1-8H |
| InChIKey | UJCACAOPZBJKIW-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C=O)=C2)=NC=CC(C=O)=C1 |
Description and Uses
2,2′-Bipyridine-4,4′-dicarboxaldehyde is an organic building block.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![[2,2'-Bipyridine]-4,4'-dicarbaldehyde](https://img.chemicalbook.com/CAS/GIF/99970-84-0.gif)


![[2,2'-Bipyridine]-6,6'-diyldimethanol](https://img.chemicalbook.com/CAS/20180808/GIF/74065-63-7.gif)


