BD1041948
1,1-Di-tert-butoxy-N,N-dimethylmethanamine , 90% , 36805-97-7
Synonym(s):
1,1-Di-tert-butoxy-N,N-dimethylmethylamine;1,1-Di-tert-butoxytrimethylamine
CAS NO.:36805-97-7
Empirical Formula: C11H25NO2
Molecular Weight: 203.32
MDL number: MFCD00015002
EINECS: 253-222-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB52.00 | In Stock |
|
| 5g | RMB236.80 | In Stock |
|
| 25g | RMB861.60 | In Stock |
|
| 100g | RMB3386.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 56-57 °C8 mm Hg(lit.) |
| Density | 0.848 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 93 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Miscible with toluene and benzene. |
| pka | 5.34±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.848 |
| Sensitive | Moisture Sensitive |
| BRN | 969629 |
| InChI | InChI=1S/C11H25NO2/c1-10(2,3)13-9(12(7)8)14-11(4,5)6/h9H,1-8H3 |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(OC(C)(C)C)N(C)C |
| CAS DataBase Reference | 36805-97-7(CAS DataBase Reference) |
Description and Uses
N,N-Dimethylformamide di-tert-butyl acetal may be used in the synthesis of following:
- (S)-2-(1-tert-butoxycarbonyl-2-{4-[2-(5-methyl-2-phenyloxazol-4-yl)ethoxy]phenyl}ethylamino)benzoic acid methyl ester
- 3-O-tert-butylmorphine
- tert-butylesters of pyrrole- and indolecarboxylic acids
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29221990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |





