BD1057532
1-(2-Chloroethoxy)-4-nitrobenzene , 98% , 3383-72-0
CAS NO.：3383-72-0
Empirical Formula: C8H8ClNO3
Molecular Weight: 201.61
MDL number: MFCD00674505
EINECS: 425-790-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB132.80 | In Stock |
|
| 5g | RMB332.80 | In Stock |
|
| 25g | RMB1099.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-68 °C |
| Boiling point: | 204-206 °C(Press: 25 Torr) |
| Density | 1.316±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C8H8ClNO3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,5-6H2 |
| InChIKey | OBCFOPGCTNULTG-UHFFFAOYSA-N |
| SMILES | C1(OCCCl)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 3383-72-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 9-21 |
| HazardClass | IRRITANT |
| HS Code | 2909309090 |
