BD1066332
4-(Aminomethyl)benzonitrile , 97% , 10406-25-4
CAS NO.：10406-25-4
Empirical Formula: C8H8N2
Molecular Weight: 132.16
MDL number: MFCD01861472
EINECS: 233-877-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB90.40 | In Stock |
|
| 10g | RMB175.20 | In Stock |
|
| 25g | RMB426.40 | In Stock |
|
| 100g | RMB1566.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 274-279 °C(lit.) |
| Boiling point: | 92 °C(Press: 5 Torr) |
| Density | 1.1 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 8.47±0.10(Predicted) |
| form | liquid |
| color | Dark yellow |
| InChI | InChI=1S/C8H8N2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5,9H2 |
| InChIKey | LFIWXXXFJFOECP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(CN)C=C1 |
| CAS DataBase Reference | 10406-25-4(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of Ximelagatran.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | T,Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| HazardClass | TOXIC |
| HS Code | 2926907090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
